CAS 27611-39-8 appears in our catalog under these names: 5-bromo-2,3-dihydro-1h-indene-1,3-dione, 95%, 5-bromo-2,3-dihydro-1H-indene-1,3-dione, 5-Bromo-1H-indene-1,3(2H)-dione 98%, 5-Bromo-1,3-indandione, 98%, 98%, 5-Bromo-1H-indene-1,3(2H)-dione, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 0,5g, 100mg, 10g, 25g.
5-bromoindene-1,3-dione (CAS 27611-39-8) is a chemical compound with the molecular formula C9H5BrO2 and a molecular weight of 225.04 g/mol. IUPAC name: 5-bromoindene-1,3-dione. InChIKey: ADTNQTYUZPHLAS-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2 |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 5-bromoindene-1,3-dione |
| InChIKey | ADTNQTYUZPHLAS-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)