CAS 7319-63-3 appears in our catalog under these names: 2-Bromo-1,3-indanedione, 96%, 2-Bromo-1H-indene-1,3(2H)-dione, 96%, 2-Bromo-1H-indene-1,3(2H)-dione, 95%, 95%, 2-Bromo-1,3-indanedione, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-bromoindene-1,3-dione (CAS 7319-63-3) is a chemical compound with the molecular formula C9H5BrO2 and a molecular weight of 225.04 g/mol. IUPAC name: 2-bromoindene-1,3-dione. InChIKey: DJSJIJDUPBUBKX-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2 |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 2-bromoindene-1,3-dione |
| InChIKey | DJSJIJDUPBUBKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)Br |
Computed by PubChem (NCBI)