CAS 939-18-4 appears in our catalog under these names: 3-Bromo-2H-chromen-2-one, >95% (HPLC), 3–Bromo–2H–chromen–2–one, 3-Bromo-2H-chromen-2-one 98%, 2H-1-Benzopyran-2-one, 3-bromo-, 97%, 97%, 3-Bromo-2-chromenone, 97%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 500mg, 250mg, 5g, 10g.
3-bromochromen-2-one (CAS 939-18-4) is a chemical compound with the molecular formula C9H5BrO2 and a molecular weight of 225.04 g/mol. IUPAC name: 3-bromochromen-2-one. InChIKey: DZCTYFCCOGXULA-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2 |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 3-bromochromen-2-one |
| InChIKey | DZCTYFCCOGXULA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)Br |
Computed by PubChem (NCBI)