cas: 1083168-88-0 — see every product listed under this CAS number, including other names
5-Bromo-1-[2-(methylsulfonyl)ethyl]pyridin-2(1H)-one, 95%+, 95%+ (CAS 1083168-88-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HB64-100mg |
| cas | 1083168-88-0 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 5g | 2771.60 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
5-bromo-1-(2-methylsulfonylethyl)pyridin-2-one (CAS 1083168-88-0) is a chemical compound with the molecular formula C8H10BrNO3S and a molecular weight of 280.14 g/mol. IUPAC name: 5-bromo-1-(2-methylsulfonylethyl)pyridin-2-one. InChIKey: AGNQYMOWIBRFNN-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO3S |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 5-bromo-1-(2-methylsulfonylethyl)pyridin-2-one |
| InChIKey | AGNQYMOWIBRFNN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCN1C=C(C=CC1=O)Br |
Computed by PubChem (NCBI)