CAS 59724-43-5 is the registry number for N-(2-Hydroxyethyl) 4-bromobenzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
4-bromo-N-(2-hydroxyethyl)benzenesulfonamide (CAS 59724-43-5) is a chemical compound with the molecular formula C8H10BrNO3S and a molecular weight of 280.14 g/mol. IUPAC name: 4-bromo-N-(2-hydroxyethyl)benzenesulfonamide. InChIKey: SYFKBNOLTPSXPQ-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO3S |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 4-bromo-N-(2-hydroxyethyl)benzenesulfonamide |
| InChIKey | SYFKBNOLTPSXPQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)NCCO)Br |
Computed by PubChem (NCBI)