CAS 911111-96-1 is the registry number for 3-Bromo-N-(2-hydroxyethyl)benzenesulfonamide, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
3-bromo-N-(2-hydroxyethyl)benzenesulfonamide (CAS 911111-96-1) is a chemical compound with the molecular formula C8H10BrNO3S and a molecular weight of 280.14 g/mol. IUPAC name: 3-bromo-N-(2-hydroxyethyl)benzenesulfonamide. InChIKey: QRDZBHKLJOEWGW-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO3S |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 3-bromo-N-(2-hydroxyethyl)benzenesulfonamide |
| InChIKey | QRDZBHKLJOEWGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)S(=O)(=O)NCCO |
Computed by PubChem (NCBI)