CAS 24138-28-1 appears in our catalog under these names: Sulbactam Impurity 1 (6-alpha-Bromopenicllanic Acid), Sulbactam Impurity 15, 6Alpha-Bromopenicillanic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(2S,5R,6S)-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 24138-28-1) is a chemical compound with the molecular formula C8H10BrNO3S and a molecular weight of 280.14 g/mol. IUPAC name: (2S,5R,6S)-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: DAVPSCAAXXVSFU-RVJQKOHUSA-N.
| Molecular formula | C8H10BrNO3S |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | (2S,5R,6S)-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | DAVPSCAAXXVSFU-RVJQKOHUSA-N |
| SMILES | CC1([C@@H](N2[C@H](S1)[C@H](C2=O)Br)C(=O)O)C |
Computed by PubChem (NCBI)