CAS 405281-53-0 is the registry number for 5-Bromo-2-hydroxy-n,n-dimethyl-benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
5-bromo-2-hydroxy-N,N-dimethylbenzenesulfonamide (CAS 405281-53-0) is a chemical compound with the molecular formula C8H10BrNO3S and a molecular weight of 280.14 g/mol. IUPAC name: 5-bromo-2-hydroxy-N,N-dimethylbenzenesulfonamide. InChIKey: PJZGKCFEAGIHCO-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO3S |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 5-bromo-2-hydroxy-N,N-dimethylbenzenesulfonamide |
| InChIKey | PJZGKCFEAGIHCO-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=CC(=C1)Br)O |
Computed by PubChem (NCBI)