cas: 16726-67-3 — see every product listed under this CAS number, including other names
5-Bromo-1-naphthoic acid, 95% (CAS 16726-67-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F214702-1G |
| cas | 16726-67-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 221.81 Pln | |
| Fluorochem | 10g | 357.18 Pln | |
| Fluorochem | 25g | 784.12 Pln | |
| Fluorochem | 100g | 2871.92 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-bromonaphthalene-1-carboxylic acid (CAS 16726-67-3) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 5-bromonaphthalene-1-carboxylic acid. InChIKey: SZFXXNVLSUTKJF-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 5-bromonaphthalene-1-carboxylic acid |
| InChIKey | SZFXXNVLSUTKJF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2Br)C(=C1)C(=O)O |
Computed by PubChem (NCBI)