5-Bromo-1-naphthoic acid, 98%
cas: 16726-67-3 — see every product listed under this CAS number, including other names
5-Bromo-1-naphthoic acid, 98% (CAS 16726-67-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A130338-250mg |
| cas | 16726-67-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 10g | 381.50 Pln | |
| Ambeed | 25g | 809.81 Pln | |
| Ambeed | 100g | 2895.75 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 253.27 Pln | |
| BLDpharm | 10g | 408.77 Pln | |
| BLDpharm | 25g | 869.72 Pln | |
| BLDpharm | 100g | 3257.77 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-bromonaphthalene-1-carboxylic acid (CAS 16726-67-3) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 5-bromonaphthalene-1-carboxylic acid. InChIKey: SZFXXNVLSUTKJF-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 5-bromonaphthalene-1-carboxylic acid |
| InChIKey | SZFXXNVLSUTKJF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2Br)C(=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-bromonaphthalene-1-carboxylic acid, 5-bromo-1-naphthoic acid, 5-Bromo-naphthalene-1-carboxylic acid, 5-bromonaphthalenecarboxylic acid, 5-Bromonapthoic acid, 5-bromo-1-naphtoic acid, 5-bromo-1-napthoic acid, 5-bromo-1- naphthoic acid, SZFXXNVLSUTKJF-UHFFFAOYSA-N, 5-bromo-naphthalene-1carboxylic acid