cas: 1823871-92-6 — see every product listed under this CAS number, including other names
5-Bromo-2,3-difluoro-4-methylbenzaldehyde (CAS 1823871-92-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630728-1G |
| cas | 1823871-92-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2981.26 Pln | |
| Fluorochem | 5g | 8812.54 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-2,3-difluoro-4-methylbenzaldehyde (CAS 1823871-92-6) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 5-bromo-2,3-difluoro-4-methylbenzaldehyde. InChIKey: MSKVQRHXVQUKQO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 5-bromo-2,3-difluoro-4-methylbenzaldehyde |
| InChIKey | MSKVQRHXVQUKQO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1F)F)C=O)Br |
Computed by PubChem (NCBI)