CAS 173974-88-4 appears in our catalog under these names: 1-(4-Bromophenyl)-2,2-difluoroethanone, 95%, 1-(4-Bromophenyl)-2,2-difluoroethanone, 97%, 1-(4-Bromophenyl)-2,2-difluoroethanone 95%, 1-(4-Bromophenyl)-2,2-difluoroethan-1-one, 1-(4-bromophenyl)-2,2-difluoroethanone, 95%, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem, Biosynth, Chemat. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg, 50mg, 0,5g.
1-(4-bromophenyl)-2,2-difluoroethanone (CAS 173974-88-4) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2-difluoroethanone. InChIKey: AULWQWKDUPKRJT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2-difluoroethanone |
| InChIKey | AULWQWKDUPKRJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(F)F)Br |
Computed by PubChem (NCBI)