CAS 1002356-02-6 appears in our catalog under these names: 1-(3-Bromophenyl)-2,2-difluoroethanone, 95%, 1-(3-bromophenyl)-2,2-difluoroethanone, 1-(3-Bromophenyl)-2,2-difluoroethanone 95%, 1-(3-Bromophenyl)-2,2-difluoroethanone, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(3-bromophenyl)-2,2-difluoroethanone (CAS 1002356-02-6) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2-difluoroethanone. InChIKey: HZELFBPCXLKNMP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,2-difluoroethanone |
| InChIKey | HZELFBPCXLKNMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C(F)F |
Computed by PubChem (NCBI)