CAS 1805420-44-3 is the registry number for 3'-Bromo-4',5'-difluoroacetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3-bromo-4,5-difluorophenyl)ethanone (CAS 1805420-44-3) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(3-bromo-4,5-difluorophenyl)ethanone. InChIKey: ZXSAYYJRGMXVSC-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(3-bromo-4,5-difluorophenyl)ethanone |
| InChIKey | ZXSAYYJRGMXVSC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)Br)F)F |
Computed by PubChem (NCBI)