CAS 102429-07-2 appears in our catalog under these names: 2–Bromo–2′,4′–difluoroacetophenone, 2-Bromo-2',4'-difluoroacetophenone, 95%, 2-BROMO-2',4'-DIFLUOROACETOPHENONE, 97%, 2-Bromo-2',4'-difluoroacetophenone, >98.0%(GC), 2-Bromo-1-(2,4-difluorophenyl)ethanone 98%. Offered by: GLPBio, Combi-blocks, Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem. Available pack sizes: 100g, 25g, 500g, 5g, 1g.
2-bromo-1-(2,4-difluorophenyl)ethanone (CAS 102429-07-2) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 2-bromo-1-(2,4-difluorophenyl)ethanone. InChIKey: CSGDTHXBRAAOHV-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 2-bromo-1-(2,4-difluorophenyl)ethanone |
| InChIKey | CSGDTHXBRAAOHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(=O)CBr |
Computed by PubChem (NCBI)