cas: 1073339-12-4 — see every product listed under this CAS number, including other names
5-Bromo-2,3-difluorophenylboronic acid, pinacol ester, 96%, 96% (CAS 1073339-12-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EXT-100mg |
| cas | 1073339-12-4 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 698.00 Pln | |
| Chemat | 5g | 2286.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(5-bromo-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073339-12-4) is a chemical compound with the molecular formula C12H14BBrF2O2 and a molecular weight of 318.95 g/mol. IUPAC name: 2-(5-bromo-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: PFZXDLSNBLEISL-UHFFFAOYSA-N.
| Molecular formula | C12H14BBrF2O2 |
|---|---|
| Molecular weight | 318.95 g/mol |
| IUPAC name | 2-(5-bromo-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | PFZXDLSNBLEISL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)F)Br |
Computed by PubChem (NCBI)