cas: 134517-54-7 — see every product listed under this CAS number, including other names
5-Bromo-2,4-dichloroquinazoline, 95%, 95% (CAS 134517-54-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110HMH-100mg |
| cas | 134517-54-7 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 678.80 Pln | |
| Chemat | 1g | 1854.80 Pln | |
| Chemat | 5g | 5435.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2,4-dichloroquinazoline (CAS 134517-54-7) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 5-bromo-2,4-dichloroquinazoline. InChIKey: JFJWOUKXMNABQC-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 5-bromo-2,4-dichloroquinazoline |
| InChIKey | JFJWOUKXMNABQC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)