CAS 108229-82-9 appears in our catalog under these names: 6-Bromo-2,3-dichloroquinoxaline, 95%, 6-Bromo-2,3-dichloroquinoxaline 95%, 6-Bromo-2,3-dichloroquinoxaline, 95%, 95%, 6-Bromo-2,3-dichloroquinoxaline, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
6-bromo-2,3-dichloroquinoxaline (CAS 108229-82-9) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 6-bromo-2,3-dichloroquinoxaline. InChIKey: PSSGUHOTRLMJNO-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 6-bromo-2,3-dichloroquinoxaline |
| InChIKey | PSSGUHOTRLMJNO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)