CAS 2065250-59-9 appears in our catalog under these names: 6-Bromo-3,4-dichloro-cinnoline, 95%, 6-Bromo-3,4-dichlorocinnoline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
6-bromo-3,4-dichlorocinnoline (CAS 2065250-59-9) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 6-bromo-3,4-dichlorocinnoline. InChIKey: CZTGSVQKAZFWAV-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 6-bromo-3,4-dichlorocinnoline |
| InChIKey | CZTGSVQKAZFWAV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=C(N=N2)Cl)Cl |
Computed by PubChem (NCBI)