CAS 1881295-60-8 is the registry number for 7-bromo-2,6-dichloroquinoxaline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
7-bromo-2,6-dichloroquinoxaline (CAS 1881295-60-8) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 7-bromo-2,6-dichloroquinoxaline. InChIKey: OTUCSFGZURLFSN-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 7-bromo-2,6-dichloroquinoxaline |
| InChIKey | OTUCSFGZURLFSN-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Br)N=C(C=N2)Cl |
Computed by PubChem (NCBI)