CAS 1566293-59-1 is the registry number for 8-Bromo-4,5-dichloroquinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-4,5-dichloroquinazoline (CAS 1566293-59-1) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 8-bromo-4,5-dichloroquinazoline. InChIKey: IVFCGFSGUFAOCL-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 8-bromo-4,5-dichloroquinazoline |
| InChIKey | IVFCGFSGUFAOCL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)C(=NC=N2)Cl)Br |
Computed by PubChem (NCBI)