cas: 1456000-34-2 — see every product listed under this CAS number, including other names
5-Bromo-2-((4-methoxybenzyl)amino)nicotinic acid, 95% (CAS 1456000-34-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A565263-100mg |
| cas | 1456000-34-2 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 1534.75 Pln | |
| AmBeed | 250mg | 3709.09 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxylic acid (CAS 1456000-34-2) is a chemical compound with the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. IUPAC name: 5-bromo-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxylic acid. InChIKey: DQWQZYIWJHDTRH-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O3 |
|---|---|
| Molecular weight | 337.17 g/mol |
| IUPAC name | 5-bromo-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxylic acid |
| InChIKey | DQWQZYIWJHDTRH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=C(C=C(C=N2)Br)C(=O)O |
Computed by PubChem (NCBI)