Products 2955608-64-5
CAS 2955608-64-5 appears in our catalog under these names: 3-[5-(bromomethyl)-1-oxo-2,3-dihydro-1H-isoindol-2-yl]piperidine-2,6-dione, 96%, 96%, 3-(5-(Bromomethyl)-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-[6-(bromomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2955608-64-5) is a chemical compound with the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. IUPAC name: 3-[6-(bromomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: OWSFJHIRNMNPCK-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O3 |
|---|---|
| Molecular weight | 337.17 g/mol |
| IUPAC name | 3-[6-(bromomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | OWSFJHIRNMNPCK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)CBr |
Computed by PubChem (NCBI)