Products 2306055-12-7
CAS 2306055-12-7 is the registry number for 3-Bromo-N5-cyclopropyl-N7-methylbenzofuran-5,7-dicarboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5-N-cyclopropyl-7-N-methyl-1-benzofuran-5,7-dicarboxamide (CAS 2306055-12-7) is a chemical compound with the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. IUPAC name: 3-bromo-5-N-cyclopropyl-7-N-methyl-1-benzofuran-5,7-dicarboxamide. InChIKey: ZMJIBJVMJWBQGR-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O3 |
|---|---|
| Molecular weight | 337.17 g/mol |
| IUPAC name | 3-bromo-5-N-cyclopropyl-7-N-methyl-1-benzofuran-5,7-dicarboxamide |
| InChIKey | ZMJIBJVMJWBQGR-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CC2=C1OC=C2Br)C(=O)NC3CC3 |
Computed by PubChem (NCBI)