cas: 436799-36-9 — see every product listed under this CAS number, including other names
5-Bromo-2-(trifluoromethyl)nicotinic acid 96% (CAS 436799-36-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A115040-100mg |
| cas | 436799-36-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1850.00 Pln | |
| Ambeed | 5g | 6305.56 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A115040 |
5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 436799-36-9) is a chemical compound with the molecular formula C7H3BrF3NO2 and a molecular weight of 270.00 g/mol. IUPAC name: 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: OJBOBCNVNGPQGR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO2 |
|---|---|
| Molecular weight | 270.00 g/mol |
| IUPAC name | 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | OJBOBCNVNGPQGR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)C(F)(F)F)Br |
Computed by PubChem (NCBI)