CAS 1060810-71-0 appears in our catalog under these names: 4-Bromo-6-(trifluoromethyl)nicotinic acid, 95%, 4–Bromo–6–(trifluoromethyl)nicotinic acid, 4-Bromo-6-(trifluoromethyl)nicotinic acid 95%, 4-Bromo-6-(trifluoromethyl)nicotinic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 50mg.
4-bromo-6-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 1060810-71-0) is a chemical compound with the molecular formula C7H3BrF3NO2 and a molecular weight of 270.00 g/mol. IUPAC name: 4-bromo-6-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: LWVCDUWLIWOLBB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO2 |
|---|---|
| Molecular weight | 270.00 g/mol |
| IUPAC name | 4-bromo-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | LWVCDUWLIWOLBB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)C(=O)O)Br |
Computed by PubChem (NCBI)