Products 959245-76-2
CAS 959245-76-2 appears in our catalog under these names: 3-Bromo-5-(trifluoromethyl)picolinic acid, 95%, 3–Bromo–5–(trifluoromethyl)picolinic acid, 3-Bromo-5-(trifluoromethyl)picolinic acid, 98%, 98%, 3-Bromo-5-(trifluoromethyl)picolinic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
3-bromo-5-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 959245-76-2) is a chemical compound with the molecular formula C7H3BrF3NO2 and a molecular weight of 270.00 g/mol. IUPAC name: 3-bromo-5-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: DGCOFXUWTIYTNZ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO2 |
|---|---|
| Molecular weight | 270.00 g/mol |
| IUPAC name | 3-bromo-5-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | DGCOFXUWTIYTNZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)