Products 1805579-11-6
CAS 1805579-11-6 is the registry number for 6-Bromo-5-(trifluoromethyl)nicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-bromo-5-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 1805579-11-6) is a chemical compound with the molecular formula C7H3BrF3NO2 and a molecular weight of 270.00 g/mol. IUPAC name: 6-bromo-5-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: ROFHPSYCGBNEEP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO2 |
|---|---|
| Molecular weight | 270.00 g/mol |
| IUPAC name | 6-bromo-5-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | ROFHPSYCGBNEEP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)Br)C(=O)O |
Computed by PubChem (NCBI)