CAS 749875-07-8 appears in our catalog under these names: 2-Bromo-6-(trifluoromethyl)nicotinic acid, 95%, 2-Bromo-6-trifluoromethyl-3-pyridinecarboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
2-bromo-6-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 749875-07-8) is a chemical compound with the molecular formula C7H3BrF3NO2 and a molecular weight of 270.00 g/mol. IUPAC name: 2-bromo-6-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: YLKWDJIZOAKOIM-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO2 |
|---|---|
| Molecular weight | 270.00 g/mol |
| IUPAC name | 2-bromo-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | YLKWDJIZOAKOIM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)Br)C(F)(F)F |
Computed by PubChem (NCBI)