cas: 163452-78-6 — see every product listed under this CAS number, including other names
5-Bromo-2-chloropyridine-3,4-diamine 97% (CAS 163452-78-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A255069-250mg |
| cas | 163452-78-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 10g | 398.19 Pln | |
| Ambeed | 25g | 804.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A255069 |
5-bromo-2-chloropyridine-3,4-diamine (CAS 163452-78-6) is a chemical compound with the molecular formula C5H5BrClN3 and a molecular weight of 222.47 g/mol. IUPAC name: 5-bromo-2-chloropyridine-3,4-diamine. InChIKey: IFEZDSVRWYQAJR-UHFFFAOYSA-N.
| Molecular formula | C5H5BrClN3 |
|---|---|
| Molecular weight | 222.47 g/mol |
| IUPAC name | 5-bromo-2-chloropyridine-3,4-diamine |
| InChIKey | IFEZDSVRWYQAJR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)N)N)Br |
Computed by PubChem (NCBI)