cas: 393-37-3 — see every product listed under this CAS number, including other names
5-Bromo-2-fluorobenzotrifluoride, 98%, 98% (CAS 393-37-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HA2-1g |
| cas | 393-37-3 |
| size | 1g |
| availability | 1375g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 100g | 174.80 Pln | |
| Chemat | 500g | 686.40 Pln | |
| Chemat | 1kg | 1192.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-1-fluoro-2-(trifluoromethyl)benzene (CAS 393-37-3) is a chemical compound with the molecular formula C7H3BrF4 and a molecular weight of 243.00 g/mol. IUPAC name: 4-bromo-1-fluoro-2-(trifluoromethyl)benzene. InChIKey: AJLIJYGWAXPEOK-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4 |
|---|---|
| Molecular weight | 243.00 g/mol |
| IUPAC name | 4-bromo-1-fluoro-2-(trifluoromethyl)benzene |
| InChIKey | AJLIJYGWAXPEOK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)F |
Computed by PubChem (NCBI)