cas: 688047-09-8 — see every product listed under this CAS number, including other names
5-Bromo-2-methoxy-4-(trifluoromethyl)pyridine 97% (CAS 688047-09-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A439832-250mg |
| cas | 688047-09-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 698.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A439832 |
5-bromo-2-methoxy-4-(trifluoromethyl)pyridine (CAS 688047-09-8) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 5-bromo-2-methoxy-4-(trifluoromethyl)pyridine. InChIKey: YNBRJYBSNIWSTM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 5-bromo-2-methoxy-4-(trifluoromethyl)pyridine |
| InChIKey | YNBRJYBSNIWSTM-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)