Products 107650-20-4
CAS 107650-20-4 appears in our catalog under these names: 5-Bromo-2-methyl-3-nitrobenzoic acid, 97%, 97%, 5-Bromo-2-methyl-3-nitrobenzoic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g.
5-bromo-2-methyl-3-nitrobenzoic acid (CAS 107650-20-4) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: 5-bromo-2-methyl-3-nitrobenzoic acid. InChIKey: DXUUJILVHXQDCV-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | 5-bromo-2-methyl-3-nitrobenzoic acid |
| InChIKey | DXUUJILVHXQDCV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])Br)C(=O)O |
Computed by PubChem (NCBI)