cas: 20357-20-4 — see every product listed under this CAS number, including other names
5-Bromo-2-nitrobenzaldehyde, 97%, 97% (CAS 20357-20-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 250g, 500g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1139ZR-250mg |
| cas | 20357-20-4 |
| size | 250mg |
| availability | 913.75g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 250g | 765.20 Pln | |
| Chemat | 500g | 1536.00 Pln | |
| Chemat | 50g | 203.60 Pln | |
| Chemat | 100g | 342.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-nitrobenzaldehyde (CAS 20357-20-4) is a chemical compound with the molecular formula C7H4BrNO3 and a molecular weight of 230.02 g/mol. IUPAC name: 5-bromo-2-nitrobenzaldehyde. InChIKey: UFRVBZVJVRHSNR-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | 5-bromo-2-nitrobenzaldehyde |
| InChIKey | UFRVBZVJVRHSNR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)