cas: 882093-01-8 — see every product listed under this CAS number, including other names
5-Bromo-2-propoxybenzamide, 98%, 98% (CAS 882093-01-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12NZNP-100mg |
| cas | 882093-01-8 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1864.40 Pln | |
| Chemat | 250mg | 3242.00 Pln | |
| Chemat | 1g | 7576.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-propoxybenzamide (CAS 882093-01-8) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: 5-bromo-2-propoxybenzamide. InChIKey: UKIRLYISEHSNAT-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 5-bromo-2-propoxybenzamide |
| InChIKey | UKIRLYISEHSNAT-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1)Br)C(=O)N |
Computed by PubChem (NCBI)