cas: 114042-02-3 — see every product listed under this CAS number, including other names
5-Bromo-3-methyl-2-nitropyridine, 95%, 95% (CAS 114042-02-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111AD3-25g |
| cas | 114042-02-3 |
| size | 25g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 995.60 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 472.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-3-methyl-2-nitropyridine (CAS 114042-02-3) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 5-bromo-3-methyl-2-nitropyridine. InChIKey: VKFNGESSJFKZEK-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 5-bromo-3-methyl-2-nitropyridine |
| InChIKey | VKFNGESSJFKZEK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)