cas: 1138326-95-0 — see every product listed under this CAS number, including other names
5-Bromo-4-phenylthiophene-2-carbaldehyde, ≥95%, ≥95% (CAS 1138326-95-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DEI5-100mg |
| cas | 1138326-95-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 587.60 Pln | |
| Chemat | 5g | 2354.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-4-phenylthiophene-2-carbaldehyde (CAS 1138326-95-0) is a chemical compound with the molecular formula C11H7BrOS and a molecular weight of 267.14 g/mol. IUPAC name: 5-bromo-4-phenylthiophene-2-carbaldehyde. InChIKey: ZMAPHWPOKXUIHE-UHFFFAOYSA-N.
| Molecular formula | C11H7BrOS |
|---|---|
| Molecular weight | 267.14 g/mol |
| IUPAC name | 5-bromo-4-phenylthiophene-2-carbaldehyde |
| InChIKey | ZMAPHWPOKXUIHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=C2)C=O)Br |
Computed by PubChem (NCBI)