cas: 869188-52-3 — see every product listed under this CAS number, including other names
5-Bromo-6-chloro-2,2-difluorobenzo[d][1,3]dioxole, tech grade, 95%, 95% (CAS 869188-52-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115OEA-50mg |
| cas | 869188-52-3 |
| size | 50mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 270.80 Pln | |
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 693.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-6-chloro-2,2-difluoro-1,3-benzodioxole (CAS 869188-52-3) is a chemical compound with the molecular formula C7H2BrClF2O2 and a molecular weight of 271.44 g/mol. IUPAC name: 5-bromo-6-chloro-2,2-difluoro-1,3-benzodioxole. InChIKey: XTQZJIDYGRBKKT-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF2O2 |
|---|---|
| Molecular weight | 271.44 g/mol |
| IUPAC name | 5-bromo-6-chloro-2,2-difluoro-1,3-benzodioxole |
| InChIKey | XTQZJIDYGRBKKT-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Br)OC(O2)(F)F |
Computed by PubChem (NCBI)