CAS 2487481-74-1 is the registry number for 4-Bromo-5-chloro-2,3-difluorobenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-5-chloro-2,3-difluorobenzoic acid (CAS 2487481-74-1) is a chemical compound with the molecular formula C7H2BrClF2O2 and a molecular weight of 271.44 g/mol. IUPAC name: 4-bromo-5-chloro-2,3-difluorobenzoic acid. InChIKey: RYVAAUGQALHTQW-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF2O2 |
|---|---|
| Molecular weight | 271.44 g/mol |
| IUPAC name | 4-bromo-5-chloro-2,3-difluorobenzoic acid |
| InChIKey | RYVAAUGQALHTQW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Br)F)F)C(=O)O |
Computed by PubChem (NCBI)