Products 2628415-46-1
CAS 2628415-46-1 is the registry number for 2-Bromo-4-chloro-3,6-difluorobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4-chloro-3,6-difluorobenzoic acid (CAS 2628415-46-1) is a chemical compound with the molecular formula C7H2BrClF2O2 and a molecular weight of 271.44 g/mol. IUPAC name: 2-bromo-4-chloro-3,6-difluorobenzoic acid. InChIKey: PKUBNTXCWOIJDQ-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF2O2 |
|---|---|
| Molecular weight | 271.44 g/mol |
| IUPAC name | 2-bromo-4-chloro-3,6-difluorobenzoic acid |
| InChIKey | PKUBNTXCWOIJDQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)F)Br)C(=O)O)F |
Computed by PubChem (NCBI)