Products 2487480-03-3
CAS 2487480-03-3 appears in our catalog under these names: 4-Bromo-3-chloro-2,5-difluorobenzoic acid, 98%, 4-Bromo-3-chloro-2,5-difluorobenzoic acid, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-bromo-3-chloro-2,5-difluorobenzoic acid (CAS 2487480-03-3) is a chemical compound with the molecular formula C7H2BrClF2O2 and a molecular weight of 271.44 g/mol. IUPAC name: 4-bromo-3-chloro-2,5-difluorobenzoic acid. InChIKey: JGHBRRFETZEVFX-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF2O2 |
|---|---|
| Molecular weight | 271.44 g/mol |
| IUPAC name | 4-bromo-3-chloro-2,5-difluorobenzoic acid |
| InChIKey | JGHBRRFETZEVFX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)Cl)F)C(=O)O |
Computed by PubChem (NCBI)