5-Bromo-6-ethylisoquinoline, 95%
cas: 679433-93-3 — see every product listed under this CAS number, including other names
5-Bromo-6-ethylisoquinoline, 95% (CAS 679433-93-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1497326-100mg |
| cas | 679433-93-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 1521.81 Pln | |
| BLDpharm | 100mg | 480.97 Pln | |
| BLDpharm | 250mg | 708.66 Pln | |
| BLDpharm | 1g | 1636.12 Pln | |
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 837.20 Pln | |
| Chemat | 1g | 1998.80 Pln | |
| Fluorochem | 100mg | 1060.06 Pln | |
| Fluorochem | 250mg | 1554.68 Pln | |
| Fluorochem | 1g | 3694.55 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-bromo-6-ethylisoquinoline (CAS 679433-93-3) is a chemical compound with the molecular formula C11H10BrN and a molecular weight of 236.11 g/mol. IUPAC name: 5-bromo-6-ethylisoquinoline. InChIKey: LUBLWXXDXUAREB-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | 5-bromo-6-ethylisoquinoline |
| InChIKey | LUBLWXXDXUAREB-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(C=C1)C=NC=C2)Br |
Computed by PubChem (NCBI)