CAS 1189106-78-2 appears in our catalog under these names: 6-Bromo-2,8-dimethylquinoline, 95%, 6-Bromo-2,8-dimethylquinoline, 95+%, 6–Bromo–2,8–dimethylquinoline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 5g, 1g.
6-bromo-2,8-dimethylquinoline (CAS 1189106-78-2) is a chemical compound with the molecular formula C11H10BrN and a molecular weight of 236.11 g/mol. IUPAC name: 6-bromo-2,8-dimethylquinoline. InChIKey: RZJSSQBKYWNNAW-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | 6-bromo-2,8-dimethylquinoline |
| InChIKey | RZJSSQBKYWNNAW-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=C(C=C2C)Br |
Computed by PubChem (NCBI)