CAS 1070879-33-2 appears in our catalog under these names: 4-Bromo-5,7-dimethylquinoline, 95%, 4-Bromo-5,7-dimethylquinoline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
4-bromo-5,7-dimethylquinoline (CAS 1070879-33-2) is a chemical compound with the molecular formula C11H10BrN and a molecular weight of 236.11 g/mol. IUPAC name: 4-bromo-5,7-dimethylquinoline. InChIKey: OLXVUFILQVHTOS-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | 4-bromo-5,7-dimethylquinoline |
| InChIKey | OLXVUFILQVHTOS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=CC(=C2C(=C1)C)Br |
Computed by PubChem (NCBI)