CAS 1189106-33-9 is the registry number for 7-Bromo-2,8-dimethylquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
7-bromo-2,8-dimethylquinoline (CAS 1189106-33-9) is a chemical compound with the molecular formula C11H10BrN and a molecular weight of 236.11 g/mol. IUPAC name: 7-bromo-2,8-dimethylquinoline. InChIKey: AQDJLDMULIKQQR-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | 7-bromo-2,8-dimethylquinoline |
| InChIKey | AQDJLDMULIKQQR-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC(=C2C)Br |
Computed by PubChem (NCBI)