CAS 103858-47-5 appears in our catalog under these names: 2-Bromo-4,6-dimethylquinoline, 95%, 2-Bromo-4,6-dimethylquinoline, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-bromo-4,6-dimethylquinoline (CAS 103858-47-5) is a chemical compound with the molecular formula C11H10BrN and a molecular weight of 236.11 g/mol. IUPAC name: 2-bromo-4,6-dimethylquinoline. InChIKey: PVPUBDATKWOMSJ-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | 2-bromo-4,6-dimethylquinoline |
| InChIKey | PVPUBDATKWOMSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C=C2C)Br |
Computed by PubChem (NCBI)