cas: 118897-99-7 — see every product listed under this CAS number, including other names
5-Bromo-6-fluoroindoline-2,3-dione, 95% (CAS 118897-99-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F319915-250MG |
| cas | 118897-99-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 2392.93 Pln | |
| Fluorochem | 10g | 4236.03 Pln | |
| Fluorochem | 25g | 7812.89 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-6-fluoro-1H-indole-2,3-dione (CAS 118897-99-7) is a chemical compound with the molecular formula C8H3BrFNO2 and a molecular weight of 244.02 g/mol. IUPAC name: 5-bromo-6-fluoro-1H-indole-2,3-dione. InChIKey: LNXMNYMNZYJVFX-UHFFFAOYSA-N.
| Molecular formula | C8H3BrFNO2 |
|---|---|
| Molecular weight | 244.02 g/mol |
| IUPAC name | 5-bromo-6-fluoro-1H-indole-2,3-dione |
| InChIKey | LNXMNYMNZYJVFX-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)F)NC(=O)C2=O |
Computed by PubChem (NCBI)