CAS 1374208-41-9 appears in our catalog under these names: 6-Bromo-5-fluoroindoline-2,3-dione, 97%, 6-bromo-5-fluoroindoline-2,3-dione, 6-Bromo-5-fluoro-1H-indole-2,3-dione, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 5g, 100mg, 1g, 250mg.
6-bromo-5-fluoro-1H-indole-2,3-dione (CAS 1374208-41-9) is a chemical compound with the molecular formula C8H3BrFNO2 and a molecular weight of 244.02 g/mol. IUPAC name: 6-bromo-5-fluoro-1H-indole-2,3-dione. InChIKey: ZWODPNMMHAURNN-UHFFFAOYSA-N.
| Molecular formula | C8H3BrFNO2 |
|---|---|
| Molecular weight | 244.02 g/mol |
| IUPAC name | 6-bromo-5-fluoro-1H-indole-2,3-dione |
| InChIKey | ZWODPNMMHAURNN-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)Br)NC(=O)C2=O |
Computed by PubChem (NCBI)