CAS 2044902-62-5 appears in our catalog under these names: 4-Bromo-5-fluoroindoline-2,3-dione, 4-Bromo-5-fluoro-2,3-dihydro-1h-indole-2,3-dione, 98%, 4-Bromo-5-fluoro-2,3-dihydro-1H-indole-2,3-dione, 95%, 4-Bromo-5-fluoro-2,3-dihydro-1H-indole-2,3-dione, >97%, >97%. Offered by: Biosynth, Combi-blocks, AmBeed, Chemat. Available pack sizes: 0,5g, 5g, 250mg, 10g, 1g, 100mg.
4-bromo-5-fluoro-1H-indole-2,3-dione (CAS 2044902-62-5) is a chemical compound with the molecular formula C8H3BrFNO2 and a molecular weight of 244.02 g/mol. IUPAC name: 4-bromo-5-fluoro-1H-indole-2,3-dione. InChIKey: BAWKJYZQQZETLE-UHFFFAOYSA-N.
| Molecular formula | C8H3BrFNO2 |
|---|---|
| Molecular weight | 244.02 g/mol |
| IUPAC name | 4-bromo-5-fluoro-1H-indole-2,3-dione |
| InChIKey | BAWKJYZQQZETLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC(=O)C2=O)Br)F |
Computed by PubChem (NCBI)