CAS 874830-75-8 appears in our catalog under these names: 5-Bromo-7-fluoroindoline-2,3-dione 95+%, 5-Bromo-7-fluoroindoline-2,3-dione, 95%+, 95%+, 5-Bromo-7-fluoro-2,3-dihydro-1h-indole-2,3-dione, 95+%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
5-bromo-7-fluoro-1H-indole-2,3-dione (CAS 874830-75-8) is a chemical compound with the molecular formula C8H3BrFNO2 and a molecular weight of 244.02 g/mol. IUPAC name: 5-bromo-7-fluoro-1H-indole-2,3-dione. InChIKey: YLDKCLPACIIYJC-UHFFFAOYSA-N.
| Molecular formula | C8H3BrFNO2 |
|---|---|
| Molecular weight | 244.02 g/mol |
| IUPAC name | 5-bromo-7-fluoro-1H-indole-2,3-dione |
| InChIKey | YLDKCLPACIIYJC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)F)Br |
Computed by PubChem (NCBI)